C24H30FN3O2 — CID 55738492
2-[2-(butylamino)-2-oxoethyl]-N-[2-(4-fluorophenyl)ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 55738492) has the molecular formula C24H30FN3O2 and a molecular weight of 411.52 g/mol. Its IUPAC name is 2-[2-(butylamino)-2-oxoethyl]-N-[2-(4-fluorophenyl)ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[2-(butylamino)-2-oxoethyl]-N-[2-(4-fluorophenyl)ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55738492 |
| Molecular Formula | C24H30FN3O2 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2-[2-(butylamino)-2-oxoethyl]-N-[2-(4-fluorophenyl)ethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCNC(=O)CN1Cc2ccccc2CC1C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H30FN3O2/c1-2-3-13-26-23(29)17-28-16-20-7-5-4-6-19(20)15-22(28)24(30)27-14-12-18-8-10-21(25)11-9-18/h4-11,22H,2-3,12-17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | GZMJNLRABGZKQJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|