C20H27N5O2 — CID 55738803
2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 55738803) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 55738803 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)carbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)NC2CCCc3c2cnn3C)c(C)c1 |
| InChI | InChI=1S/C20H27N5O2/c1-12-8-13(2)19(14(3)9-12)24-18(26)11-21-20(27)23-16-6-5-7-17-15(16)10-22-25(17)4/h8-10,16H,5-7,11H2,1-4H3,(H,24,26)(H2,21,23,27) |
| InChIKey | NBRAZSVPGGNJFH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |