C25H29N5O6 — CID 55739972
ethyl 4-(4-methoxyphenyl)-6-[[4-(3-nitrophenyl)piperazin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55739972) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-6-[[4-(3-nitrophenyl)piperazin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-6-[[4-(3-nitrophenyl)piperazin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55739972 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-6-[[4-(3-nitrophenyl)piperazin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2CCN(c3cccc([N+](=O)[O-])c3)CC2)NC(=O)NC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H29N5O6/c1-3-36-24(31)22-21(26-25(32)27-23(22)17-7-9-20(35-2)10-8-17)16-28-11-13-29(14-12-28)18-5-4-6-19(15-18)30(33)34/h4-10,15,23H,3,11-14,16H2,1-2H3,(H2,26,27,32) |
| InChIKey | TXDJWDYCJFACPC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|