C24H24ClN3O2 — CID 55740460
1-(3-chlorobenzoyl)-N-[(3-cyanophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 55740460) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 1-(3-chlorobenzoyl)-N-[(3-cyanophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | 1-(3-chlorobenzoyl)-N-[(3-cyanophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 55740460 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-(3-chlorobenzoyl)-N-[(3-cyanophenyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)C2CC3CCCCC3N2C(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H24ClN3O2/c25-20-9-4-8-19(12-20)24(30)28-21-10-2-1-7-18(21)13-22(28)23(29)27-15-17-6-3-5-16(11-17)14-26/h3-6,8-9,11-12,18,21-22H,1-2,7,10,13,15H2,(H,27,29) |
| InChIKey | OBMSPBDDZXCEEX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |