C14H11N7O — CID 557420
N-(furan-2-ylmethyl)-3-phenyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine (PubChem CID 557420) has the molecular formula C14H11N7O and a molecular weight of 293.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-phenyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine.
| Compound Name | N-(furan-2-ylmethyl)-3-phenyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine |
|---|---|
| PubChem CID | 557420 |
| Molecular Formula | C14H11N7O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-phenyl-[1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-amine |
| SMILES | c1ccc(-c2nnc3nnc(NCc4ccco4)nn23)cc1 |
| InChI | InChI=1S/C14H11N7O/c1-2-5-10(6-3-1)12-16-18-14-19-17-13(20-21(12)14)15-9-11-7-4-8-22-11/h1-8H,9H2,(H,15,20) |
| InChIKey | LGDUGUBQUCJOLU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|