C18H27N5O5S — CID 55742297
N-(5-acetamido-2-methylphenyl)-4-morpholin-4-ylsulfonylpiperazine-1-carboxamide (PubChem CID 55742297) has the molecular formula C18H27N5O5S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-(5-acetamido-2-methylphenyl)-4-morpholin-4-ylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-(5-acetamido-2-methylphenyl)-4-morpholin-4-ylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55742297 |
| Molecular Formula | C18H27N5O5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-(5-acetamido-2-methylphenyl)-4-morpholin-4-ylsulfonylpiperazine-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(C)c(NC(=O)N2CCN(S(=O)(=O)N3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C18H27N5O5S/c1-14-3-4-16(19-15(2)24)13-17(14)20-18(25)21-5-7-22(8-6-21)29(26,27)23-9-11-28-12-10-23/h3-4,13H,5-12H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | FLSZXLCJUHLKIT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |