C20H22N4O5 — CID 55742947
N-[2-[4-(3-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-2-phenoxyacetamide (PubChem CID 55742947) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[2-[4-(3-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-[4-(3-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 55742947 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[2-[4-(3-nitrophenyl)piperazin-1-yl]-2-oxoethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H22N4O5/c25-19(15-29-18-7-2-1-3-8-18)21-14-20(26)23-11-9-22(10-12-23)16-5-4-6-17(13-16)24(27)28/h1-8,13H,9-12,14-15H2,(H,21,25) |
| InChIKey | ZTXNAPZIWIUPEU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|