C21H27N3O5 — CID 55743469
1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea (PubChem CID 55743469) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea.
| Compound Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 55743469 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]-3-[6-(2-methoxyethoxy)-3-pyridinyl]urea |
| SMILES | COCCOc1ccc(NC(=O)NC(c2ccc3c(c2)OCCO3)C(C)C)cn1 |
| InChI | InChI=1S/C21H27N3O5/c1-14(2)20(15-4-6-17-18(12-15)28-11-10-27-17)24-21(25)23-16-5-7-19(22-13-16)29-9-8-26-3/h4-7,12-14,20H,8-11H2,1-3H3,(H2,23,24,25) |
| InChIKey | KUXJNHMRLJPDKU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|