C20H30N4O4 — CID 55744255
N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55744255) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55744255 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)C2CCN(C(=O)N3CCCC3)CC2)cn1 |
| InChI | InChI=1S/C20H30N4O4/c1-27-12-13-28-18-5-4-16(14-21-18)15-22-19(25)17-6-10-24(11-7-17)20(26)23-8-2-3-9-23/h4-5,14,17H,2-3,6-13,15H2,1H3,(H,22,25) |
| InChIKey | SRWBTKXMTUEFBL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|