About 4,4-dimethoxypiperidine
4,4-dimethoxypiperidine (PubChem CID 557469) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4,4-dimethoxypiperidine.
Molecular Properties
| Compound Name | 4,4-dimethoxypiperidine |
| PubChem CID | 557469 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 4,4-dimethoxypiperidine |
| SMILES | COC1(OC)CCNCC1 |
| InChI | InChI=1S/C7H15NO2/c1-9-7(10-2)3-5-8-6-4-7/h8H,3-6H2,1-2H3 |
| InChIKey | ONHQQEBZVXXMRC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethoxypiperidine?
The IUPAC name of 4,4-dimethoxypiperidine (CID 557469) is 4,4-dimethoxypiperidine.
What is the SMILES notation for 4,4-dimethoxypiperidine?
The canonical SMILES for 4,4-dimethoxypiperidine is COC1(OC)CCNCC1.
What is the InChIKey of 4,4-dimethoxypiperidine?
The InChIKey is ONHQQEBZVXXMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-9-7(10-2)3-5-8-6-4-7/h8H,3-6H2,1-2H3.
What are the key properties of 4,4-dimethoxypiperidine?
4,4-dimethoxypiperidine has a molecular weight of 145.20 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethoxypiperidine is sourced from PubChem (CID 557469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).