C24H30N2O4 — CID 55747807
N-[1-(3-methoxy-4-propoxyphenyl)ethyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55747807) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[1-(3-methoxy-4-propoxyphenyl)ethyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[1-(3-methoxy-4-propoxyphenyl)ethyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55747807 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[1-(3-methoxy-4-propoxyphenyl)ethyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCOc1ccc(C(C)NC(=O)C2CC(=O)N(c3ccc(C)cc3)C2)cc1OC |
| InChI | InChI=1S/C24H30N2O4/c1-5-12-30-21-11-8-18(13-22(21)29-4)17(3)25-24(28)19-14-23(27)26(15-19)20-9-6-16(2)7-10-20/h6-11,13,17,19H,5,12,14-15H2,1-4H3,(H,25,28) |
| InChIKey | XEXAGMLRDJMXSW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |