C24H21N3O5 — CID 55750751
3,4-dimethoxy-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]benzamide (PubChem CID 55750751) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55750751 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)N3CC(=O)Nc4ccccc43)cc2)cc1OC |
| InChI | InChI=1S/C24H21N3O5/c1-31-20-12-9-16(13-21(20)32-2)23(29)25-17-10-7-15(8-11-17)24(30)27-14-22(28)26-18-5-3-4-6-19(18)27/h3-13H,14H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | JXZKTAUNZPDZBR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |