C20H24N2O5 — CID 55750862
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(4-methoxyphenoxy)acetate (PubChem CID 55750862) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 55750862 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)Oc2ccc(N(C)C(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-14(2)21-20(24)22(3)15-5-7-18(8-6-15)27-19(23)13-26-17-11-9-16(25-4)10-12-17/h5-12,14H,13H2,1-4H3,(H,21,24) |
| InChIKey | ZCBOBMRPTWPDCC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|