C25H22FN5O2 — CID 55750867
N-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide (PubChem CID 55750867) has the molecular formula C25H22FN5O2 and a molecular weight of 443.48 g/mol. Its IUPAC name is N-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide.
| Compound Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 55750867 |
| Molecular Formula | C25H22FN5O2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[2-(2-cyano-3-fluoroanilino)ethyl]-3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzamide |
| SMILES | Cc1ccc2nc(COc3cccc(C(=O)NCCNc4cccc(F)c4C#N)c3)cn2c1 |
| InChI | InChI=1S/C25H22FN5O2/c1-17-8-9-24-30-19(15-31(24)14-17)16-33-20-5-2-4-18(12-20)25(32)29-11-10-28-23-7-3-6-22(26)21(23)13-27/h2-9,12,14-15,28H,10-11,16H2,1H3,(H,29,32) |
| InChIKey | OIMUTLRBVHHOSC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|