C21H27N3O3S — CID 55752735
N',N'-diphenyl-1-propylsulfonylpiperidine-3-carbohydrazide (PubChem CID 55752735) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N',N'-diphenyl-1-propylsulfonylpiperidine-3-carbohydrazide.
| Compound Name | N',N'-diphenyl-1-propylsulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55752735 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N',N'-diphenyl-1-propylsulfonylpiperidine-3-carbohydrazide |
| SMILES | CCCS(=O)(=O)N1CCCC(C(=O)NN(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H27N3O3S/c1-2-16-28(26,27)23-15-9-10-18(17-23)21(25)22-24(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-8,11-14,18H,2,9-10,15-17H2,1H3,(H,22,25) |
| InChIKey | GDDUCGYJCMFCOR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|