C19H18ClN3O3S — CID 55753603
3-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-methoxybenzaldehyde (PubChem CID 55753603) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 3-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 55753603 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 3-[[5-[(2-chlorophenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CSc1nnc(COc2ccccc2Cl)n1C |
| InChI | InChI=1S/C19H18ClN3O3S/c1-23-18(11-26-17-6-4-3-5-15(17)20)21-22-19(23)27-12-14-9-13(10-24)7-8-16(14)25-2/h3-10H,11-12H2,1-2H3 |
| InChIKey | QRMYEDHEFWGKOO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|