C15H10Cl2N4O2S — CID 55754017
12-[(3,5-dichlorophenoxy)methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one (PubChem CID 55754017) has the molecular formula C15H10Cl2N4O2S and a molecular weight of 381.24 g/mol. Its IUPAC name is 12-[(3,5-dichlorophenoxy)methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one.
| Compound Name | 12-[(3,5-dichlorophenoxy)methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 55754017 |
| Molecular Formula | C15H10Cl2N4O2S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 12-[(3,5-dichlorophenoxy)methyl]-8-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-7-one |
| SMILES | Cn1c(=O)c2sccc2n2c(COc3cc(Cl)cc(Cl)c3)nnc12 |
| InChI | InChI=1S/C15H10Cl2N4O2S/c1-20-14(22)13-11(2-3-24-13)21-12(18-19-15(20)21)7-23-10-5-8(16)4-9(17)6-10/h2-6H,7H2,1H3 |
| InChIKey | VBOWMCSZPYBLKD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |