C25H32N6O3 — CID 55754944
(1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridin-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55754944) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridin-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridin-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55754944 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridin-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1nn(C(C)(C)C)c2nc(C(C)C)cc(C(=O)N3CCN(c4ccccc4[N+](=O)[O-])CC3)c12 |
| InChI | InChI=1S/C25H32N6O3/c1-16(2)19-15-18(22-17(3)27-30(23(22)26-19)25(4,5)6)24(32)29-13-11-28(12-14-29)20-9-7-8-10-21(20)31(33)34/h7-10,15-16H,11-14H2,1-6H3 |
| InChIKey | HRIVWPVSIIAECL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|