About 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one
3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one (PubChem CID 55755338) has the molecular formula C22H19Cl2N3O4S
and a molecular weight of 492.38 g/mol. Its IUPAC name is 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one |
| PubChem CID | 55755338 |
| Molecular Formula | C22H19Cl2N3O4S |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(-c2ccccc2)[nH]c1=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C22H19Cl2N3O4S/c23-16-6-8-18(24)20(14-16)32(30,31)27-12-10-26(11-13-27)22(29)17-7-9-19(25-21(17)28)15-4-2-1-3-5-15/h1-9,14H,10-13H2,(H,25,28) |
| InChIKey | BYBJJGLLKOCUMA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one?
The IUPAC name of 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one (CID 55755338) is 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one.
What is the SMILES notation for 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one?
The canonical SMILES for 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one is O=C(c1ccc(-c2ccccc2)[nH]c1=O)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1.
What is the InChIKey of 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one?
The InChIKey is BYBJJGLLKOCUMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl2N3O4S/c23-16-6-8-18(24)20(14-16)32(30,31)27-12-10-26(11-13-27)22(29)17-7-9-19(25-21(17)28)15-4-2-1-3-5-15/h1-9,14H,10-13H2,(H,25,28).
What are the key properties of 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one?
3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one has a molecular weight of 492.38 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-6-phenyl-1H-pyridin-2-one is sourced from PubChem (CID 55755338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).