C23H29N3O4S — CID 55756331
2-[4-[4-(benzenesulfonylmethyl)benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 55756331) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is 2-[4-[4-(benzenesulfonylmethyl)benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[4-(benzenesulfonylmethyl)benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55756331 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[4-[4-(benzenesulfonylmethyl)benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCN(C(=O)c2ccc(CS(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O4S/c1-18(2)24-22(27)16-25-12-14-26(15-13-25)23(28)20-10-8-19(9-11-20)17-31(29,30)21-6-4-3-5-7-21/h3-11,18H,12-17H2,1-2H3,(H,24,27) |
| InChIKey | NOBDIABOOHVXKH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |