C22H19N3O — CID 55757695
N,5-dimethyl-N-naphthalen-2-yl-1-phenylpyrazole-3-carboxamide (PubChem CID 55757695) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is N,5-dimethyl-N-naphthalen-2-yl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N,5-dimethyl-N-naphthalen-2-yl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55757695 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N,5-dimethyl-N-naphthalen-2-yl-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)c2ccc3ccccc3c2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3O/c1-16-14-21(23-25(16)19-10-4-3-5-11-19)22(26)24(2)20-13-12-17-8-6-7-9-18(17)15-20/h3-15H,1-2H3 |
| InChIKey | MXCWALKDTDVGBS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |