C24H26N2O5S — CID 55758558
ethyl 2-[benzyl-[2-(2-phenoxyethoxy)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 55758558) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is ethyl 2-[benzyl-[2-(2-phenoxyethoxy)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[benzyl-[2-(2-phenoxyethoxy)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55758558 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | ethyl 2-[benzyl-[2-(2-phenoxyethoxy)acetyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N(Cc2ccccc2)C(=O)COCCOc2ccccc2)nc1C |
| InChI | InChI=1S/C24H26N2O5S/c1-3-30-23(28)22-18(2)25-24(32-22)26(16-19-10-6-4-7-11-19)21(27)17-29-14-15-31-20-12-8-5-9-13-20/h4-13H,3,14-17H2,1-2H3 |
| InChIKey | BOXZZFNCYDWFAG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|