C25H27N5O6 — CID 55758643
1-(3,5-dimethoxybenzoyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]piperidine-4-carboxamide (PubChem CID 55758643) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55758643 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)Nc3cc(C)nn3-c3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C25H27N5O6/c1-16-12-23(29(27-16)19-4-6-20(7-5-19)30(33)34)26-24(31)17-8-10-28(11-9-17)25(32)18-13-21(35-2)15-22(14-18)36-3/h4-7,12-15,17H,8-11H2,1-3H3,(H,26,31) |
| InChIKey | BVNNARNZAQHVRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|