C27H28N2O4S — CID 55759173
1-(3,5-dimethoxybenzoyl)-N-(2-phenylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 55759173) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-(2-phenylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-(2-phenylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55759173 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-(2-phenylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)Nc3ccccc3Sc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H28N2O4S/c1-32-21-16-20(17-22(18-21)33-2)27(31)29-14-12-19(13-15-29)26(30)28-24-10-6-7-11-25(24)34-23-8-4-3-5-9-23/h3-11,16-19H,12-15H2,1-2H3,(H,28,30) |
| InChIKey | FOKQCWLSYZNIIY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |