C22H19FN2O2 — CID 55761477
N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide (PubChem CID 55761477) has the molecular formula C22H19FN2O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55761477 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-cyclopropyl-N-[(3-fluorophenyl)methyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| SMILES | O=C(c1ccc(-c2ccccc2)[nH]c1=O)N(Cc1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C22H19FN2O2/c23-17-8-4-5-15(13-17)14-25(18-9-10-18)22(27)19-11-12-20(24-21(19)26)16-6-2-1-3-7-16/h1-8,11-13,18H,9-10,14H2,(H,24,26) |
| InChIKey | BCFWSWXOIXORGA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |