C20H17ClN2O5S — CID 55763392
2-chloro-N-[2-(4-methoxyphenoxy)-3-pyridinyl]-5-methylsulfonylbenzamide (PubChem CID 55763392) has the molecular formula C20H17ClN2O5S and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-methoxyphenoxy)-3-pyridinyl]-5-methylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-(4-methoxyphenoxy)-3-pyridinyl]-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55763392 |
| Molecular Formula | C20H17ClN2O5S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-chloro-N-[2-(4-methoxyphenoxy)-3-pyridinyl]-5-methylsulfonylbenzamide |
| SMILES | COc1ccc(Oc2ncccc2NC(=O)c2cc(S(C)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O5S/c1-27-13-5-7-14(8-6-13)28-20-18(4-3-11-22-20)23-19(24)16-12-15(29(2,25)26)9-10-17(16)21/h3-12H,1-2H3,(H,23,24) |
| InChIKey | FINYWFPRLVMUPT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |