C21H31N3O3S — CID 55763584
2-[(4-cyanophenyl)methylsulfonyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]acetamide (PubChem CID 55763584) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 55763584 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonyl]-N-[3-methyl-2-(4-methylpiperidin-1-yl)butyl]acetamide |
| SMILES | CC1CCN(C(CNC(=O)CS(=O)(=O)Cc2ccc(C#N)cc2)C(C)C)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-16(2)20(24-10-8-17(3)9-11-24)13-23-21(25)15-28(26,27)14-19-6-4-18(12-22)5-7-19/h4-7,16-17,20H,8-11,13-15H2,1-3H3,(H,23,25) |
| InChIKey | OYEDQOVDAVLCLR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |