C22H19F4N3O3S — CID 55765433
N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 55765433) has the molecular formula C22H19F4N3O3S and a molecular weight of 481.47 g/mol. Its IUPAC name is N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 55765433 |
| Molecular Formula | C22H19F4N3O3S |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)phenyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)Nc1ccc(NC(=O)c3ccccc3F)cc1C(F)(F)F)CS2 |
| InChI | InChI=1S/C22H19F4N3O3S/c1-21-9-8-18(30)29(21)17(11-33-21)20(32)28-16-7-6-12(10-14(16)22(24,25)26)27-19(31)13-4-2-3-5-15(13)23/h2-7,10,17H,8-9,11H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | WLRZIICZZGFNDF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |