C21H26N4O2S — CID 55766950
1-[(4-ethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 55766950) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 55766950 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-1-(3-imidazol-1-ylpropyl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | CCOc1ccc(CN(CCCn2ccnc2)C(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C21H26N4O2S/c1-2-27-19-8-6-18(7-9-19)16-25(12-4-11-24-13-10-22-17-24)21(26)23-15-20-5-3-14-28-20/h3,5-10,13-14,17H,2,4,11-12,15-16H2,1H3,(H,23,26) |
| InChIKey | WXMNLROEMZKAOP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |