C21H22F3N5O2S — CID 55767185
4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 55767185) has the molecular formula C21H22F3N5O2S and a molecular weight of 465.50 g/mol. Its IUPAC name is 4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55767185 |
| Molecular Formula | C21H22F3N5O2S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 4-methyl-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(=O)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C21H22F3N5O2S/c1-13-17(32-19(26-13)14-6-8-15(9-7-14)21(22,23)24)18(30)25-10-4-12-29-20(31)28-11-3-2-5-16(28)27-29/h6-9H,2-5,10-12H2,1H3,(H,25,30) |
| InChIKey | JKVYMORITWPDRK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|