C18H27ClN2O3S — CID 55767227
1-butylsulfonyl-N-[(3-chlorophenyl)methyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55767227) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 1-butylsulfonyl-N-[(3-chlorophenyl)methyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-[(3-chlorophenyl)methyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55767227 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-butylsulfonyl-N-[(3-chlorophenyl)methyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)N(C)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H27ClN2O3S/c1-3-4-12-25(23,24)21-10-8-16(9-11-21)18(22)20(2)14-15-6-5-7-17(19)13-15/h5-7,13,16H,3-4,8-12,14H2,1-2H3 |
| InChIKey | JKCSGKRUPZOMHK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |