C25H28N2O2 — CID 55767815
N-methyl-2-(3-methyl-4-propan-2-ylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]acetamide (PubChem CID 55767815) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-methyl-2-(3-methyl-4-propan-2-ylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]acetamide.
| Compound Name | N-methyl-2-(3-methyl-4-propan-2-ylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55767815 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-methyl-2-(3-methyl-4-propan-2-ylphenoxy)-N-[phenyl(pyridin-2-yl)methyl]acetamide |
| SMILES | Cc1cc(OCC(=O)N(C)C(c2ccccc2)c2ccccn2)ccc1C(C)C |
| InChI | InChI=1S/C25H28N2O2/c1-18(2)22-14-13-21(16-19(22)3)29-17-24(28)27(4)25(20-10-6-5-7-11-20)23-12-8-9-15-26-23/h5-16,18,25H,17H2,1-4H3 |
| InChIKey | WDVFOAUSJQVYQK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |