C16H17BrN2O4S — CID 55768562
3-[2-[(4-bromo-3-methylphenyl)sulfonylamino]phenoxy]propanamide (PubChem CID 55768562) has the molecular formula C16H17BrN2O4S and a molecular weight of 413.29 g/mol. Its IUPAC name is 3-[2-[(4-bromo-3-methylphenyl)sulfonylamino]phenoxy]propanamide.
| Compound Name | 3-[2-[(4-bromo-3-methylphenyl)sulfonylamino]phenoxy]propanamide |
|---|---|
| PubChem CID | 55768562 |
| Molecular Formula | C16H17BrN2O4S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 3-[2-[(4-bromo-3-methylphenyl)sulfonylamino]phenoxy]propanamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccccc2OCCC(N)=O)ccc1Br |
| InChI | InChI=1S/C16H17BrN2O4S/c1-11-10-12(6-7-13(11)17)24(21,22)19-14-4-2-3-5-15(14)23-9-8-16(18)20/h2-7,10,19H,8-9H2,1H3,(H2,18,20) |
| InChIKey | KWICMRZTCGRNLT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |