C20H21N3O2S — CID 55769442
N-(2-acetamido-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide (PubChem CID 55769442) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(2-acetamido-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide.
| Compound Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 55769442 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(2-acetamido-1,3-benzothiazol-6-yl)-3-(4-ethylphenyl)propanamide |
| SMILES | CCc1ccc(CCC(=O)Nc2ccc3nc(NC(C)=O)sc3c2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-3-14-4-6-15(7-5-14)8-11-19(25)22-16-9-10-17-18(12-16)26-20(23-17)21-13(2)24/h4-7,9-10,12H,3,8,11H2,1-2H3,(H,22,25)(H,21,23,24) |
| InChIKey | CBIKYCIQPDFLFN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |