C21H32N4O — CID 55770071
1-[2-(1H-indol-3-yl)ethyl]-3-[4-(2-methylpiperidin-1-yl)butyl]urea (PubChem CID 55770071) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-3-[4-(2-methylpiperidin-1-yl)butyl]urea.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[4-(2-methylpiperidin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 55770071 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-3-[4-(2-methylpiperidin-1-yl)butyl]urea |
| SMILES | CC1CCCCN1CCCCNC(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H32N4O/c1-17-8-4-6-14-25(17)15-7-5-12-22-21(26)23-13-11-18-16-24-20-10-3-2-9-19(18)20/h2-3,9-10,16-17,24H,4-8,11-15H2,1H3,(H2,22,23,26) |
| InChIKey | WARBHHSGJOFFAW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|