About 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole
2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole (PubChem CID 557705) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 557705 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole |
| SMILES | C=CCCCCCCCC1=NC(CCCCC=C)CC1 |
| InChI | InChI=1S/C19H33N/c1-3-5-7-9-10-11-13-15-19-17-16-18(20-19)14-12-8-6-4-2/h3-4,18H,1-2,5-17H2 |
| InChIKey | JRNMZRPLKGPMHB-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole (CID 557705) is 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole is C=CCCCCCCCC1=NC(CCCCC=C)CC1.
What is the InChIKey of 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole?
The InChIKey is JRNMZRPLKGPMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N/c1-3-5-7-9-10-11-13-15-19-17-16-18(20-19)14-12-8-6-4-2/h3-4,18H,1-2,5-17H2.
What are the key properties of 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole?
2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole has a molecular weight of 275.48 g/mol, XLogP of 6.25, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-5-enyl-5-non-8-enyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 557705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).