About 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione
6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 557707) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 557707 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(CO)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C7H10N2O3/c1-8-5(4-10)3-6(11)9(2)7(8)12/h3,10H,4H2,1-2H3 |
| InChIKey | IPYDXAQZAKKMPV-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione (CID 557707) is 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione is Cn1c(CO)cc(=O)n(C)c1=O.
What is the InChIKey of 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is IPYDXAQZAKKMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-8-5(4-10)3-6(11)9(2)7(8)12/h3,10H,4H2,1-2H3.
What are the key properties of 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione?
6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 170.17 g/mol, XLogP of -1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 557707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).