C24H31N3O5S — CID 55771450
1-butylsulfonyl-N'-[2-(2-phenylphenoxy)acetyl]piperidine-4-carbohydrazide (PubChem CID 55771450) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-butylsulfonyl-N'-[2-(2-phenylphenoxy)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-butylsulfonyl-N'-[2-(2-phenylphenoxy)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55771450 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-butylsulfonyl-N'-[2-(2-phenylphenoxy)acetyl]piperidine-4-carbohydrazide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NNC(=O)COc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N3O5S/c1-2-3-17-33(30,31)27-15-13-20(14-16-27)24(29)26-25-23(28)18-32-22-12-8-7-11-21(22)19-9-5-4-6-10-19/h4-12,20H,2-3,13-18H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | SXYLLMUFIWNMRS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|