C21H24FN3O3 — CID 55774834
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-fluoro-4-methyl-5-nitrobenzamide (PubChem CID 55774834) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-fluoro-4-methyl-5-nitrobenzamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-fluoro-4-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 55774834 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-fluoro-4-methyl-5-nitrobenzamide |
| SMILES | CCC(CNC(=O)c1cc(F)c(C)c([N+](=O)[O-])c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H24FN3O3/c1-3-18(24-9-8-15-6-4-5-7-16(15)13-24)12-23-21(26)17-10-19(22)14(2)20(11-17)25(27)28/h4-7,10-11,18H,3,8-9,12-13H2,1-2H3,(H,23,26) |
| InChIKey | GAVNPVXAHLXCDK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|