About (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone
(6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone (PubChem CID 55775091) has the molecular formula C17H14ClN5OS
and a molecular weight of 371.85 g/mol. Its IUPAC name is (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone.
Molecular Properties
| Compound Name | (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone |
| PubChem CID | 55775091 |
| Molecular Formula | C17H14ClN5OS |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone |
| SMILES | Cc1cc(C(=O)N2CCSc3ccc(Cl)cc32)ccc1-n1cnnn1 |
| InChI | InChI=1S/C17H14ClN5OS/c1-11-8-12(2-4-14(11)23-10-19-20-21-23)17(24)22-6-7-25-16-5-3-13(18)9-15(16)22/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | LLNIYHDVGUISDX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone?
The IUPAC name of (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone (CID 55775091) is (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone.
What is the SMILES notation for (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone?
The canonical SMILES for (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone is Cc1cc(C(=O)N2CCSc3ccc(Cl)cc32)ccc1-n1cnnn1.
What is the InChIKey of (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone?
The InChIKey is LLNIYHDVGUISDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN5OS/c1-11-8-12(2-4-14(11)23-10-19-20-21-23)17(24)22-6-7-25-16-5-3-13(18)9-15(16)22/h2-5,8-10H,6-7H2,1H3.
What are the key properties of (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone?
(6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone has a molecular weight of 371.85 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2,3-dihydro-1,4-benzothiazin-4-yl)-[3-methyl-4-(tetrazol-1-yl)phenyl]methanone is sourced from PubChem (CID 55775091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).