C19H18ClN3O — CID 55775808
4-(4-chlorophenyl)-N-(1-phenylpyrazol-3-yl)butanamide (PubChem CID 55775808) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(1-phenylpyrazol-3-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(1-phenylpyrazol-3-yl)butanamide |
|---|---|
| PubChem CID | 55775808 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(1-phenylpyrazol-3-yl)butanamide |
| SMILES | O=C(CCCc1ccc(Cl)cc1)Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H18ClN3O/c20-16-11-9-15(10-12-16)5-4-8-19(24)21-18-13-14-23(22-18)17-6-2-1-3-7-17/h1-3,6-7,9-14H,4-5,8H2,(H,21,22,24) |
| InChIKey | IFQAOPSNYNQZON-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |