C17H20INOS — CID 55777692
N-(2,2-dimethyl-1-thiophen-2-ylpropyl)-2-iodo-3-methylbenzamide (PubChem CID 55777692) has the molecular formula C17H20INOS and a molecular weight of 413.32 g/mol. Its IUPAC name is N-(2,2-dimethyl-1-thiophen-2-ylpropyl)-2-iodo-3-methylbenzamide.
| Compound Name | N-(2,2-dimethyl-1-thiophen-2-ylpropyl)-2-iodo-3-methylbenzamide |
|---|---|
| PubChem CID | 55777692 |
| Molecular Formula | C17H20INOS |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | N-(2,2-dimethyl-1-thiophen-2-ylpropyl)-2-iodo-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(c2cccs2)C(C)(C)C)c1I |
| InChI | InChI=1S/C17H20INOS/c1-11-7-5-8-12(14(11)18)16(20)19-15(17(2,3)4)13-9-6-10-21-13/h5-10,15H,1-4H3,(H,19,20) |
| InChIKey | BFKJEGTWZYLISG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|