C23H25N3O2S2 — CID 55777793
(E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)prop-2-enamide (PubChem CID 55777793) has the molecular formula C23H25N3O2S2 and a molecular weight of 439.61 g/mol. Its IUPAC name is (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 55777793 |
| Molecular Formula | C23H25N3O2S2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (E)-3-[2-(N-acetylanilino)-1,3-thiazol-4-yl]-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)prop-2-enamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C/C(=O)NC(c2cccs2)C(C)(C)C)cs1 |
| InChI | InChI=1S/C23H25N3O2S2/c1-16(27)26(18-9-6-5-7-10-18)22-24-17(15-30-22)12-13-20(28)25-21(23(2,3)4)19-11-8-14-29-19/h5-15,21H,1-4H3,(H,25,28)/b13-12+ |
| InChIKey | LNFVCSSMJPBTGX-OUKQBFOZSA-N |
| XLogP | 5.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|