C23H15ClN4O4S — CID 55778860
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55778860) has the molecular formula C23H15ClN4O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55778860 |
| Molecular Formula | C23H15ClN4O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-3,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3C(=O)c4ccccc4C3=O)c(Cl)c2)sc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C23H15ClN4O4S/c1-11-17-20(25-10-27(2)23(17)32)33-18(11)19(29)26-12-7-8-16(15(24)9-12)28-21(30)13-5-3-4-6-14(13)22(28)31/h3-10H,1-2H3,(H,26,29) |
| InChIKey | GRNWTZPKHDMLPR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|