About 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide
5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide (PubChem CID 55779404) has the molecular formula C16H16BrNO2
and a molecular weight of 334.21 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide |
| PubChem CID | 55779404 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide |
| SMILES | Cc1cc(Br)oc1C(=O)NCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H16BrNO2/c1-10-7-14(17)20-15(10)16(19)18-9-11-5-6-12-3-2-4-13(12)8-11/h5-8H,2-4,9H2,1H3,(H,18,19) |
| InChIKey | GUJSQVASRRNDII-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide?
The IUPAC name of 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide (CID 55779404) is 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide?
The canonical SMILES for 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide is Cc1cc(Br)oc1C(=O)NCc1ccc2c(c1)CCC2.
What is the InChIKey of 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide?
The InChIKey is GUJSQVASRRNDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO2/c1-10-7-14(17)20-15(10)16(19)18-9-11-5-6-12-3-2-4-13(12)8-11/h5-8H,2-4,9H2,1H3,(H,18,19).
What are the key properties of 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide?
5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide has a molecular weight of 334.21 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)-3-methylfuran-2-carboxamide is sourced from PubChem (CID 55779404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).