C26H25N5O4 — CID 55780437
[3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55780437) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is [3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55780437 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [3-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]phenyl]-[4-(3-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc2nc(COc3cccc(C(=O)N4CCN(c5cccc([N+](=O)[O-])c5)CC4)c3)cn2c1 |
| InChI | InChI=1S/C26H25N5O4/c1-19-8-9-25-27-21(17-30(25)16-19)18-35-24-7-2-4-20(14-24)26(32)29-12-10-28(11-13-29)22-5-3-6-23(15-22)31(33)34/h2-9,14-17H,10-13,18H2,1H3 |
| InChIKey | KACANPKUZIBCRO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|