C14H13BrClNO3S2 — CID 55780788
N-[(4-bromothiophen-2-yl)methyl]-2-chloro-N-methyl-5-methylsulfonylbenzamide (PubChem CID 55780788) has the molecular formula C14H13BrClNO3S2 and a molecular weight of 422.75 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-chloro-N-methyl-5-methylsulfonylbenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-chloro-N-methyl-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 55780788 |
| Molecular Formula | C14H13BrClNO3S2 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 420.92 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-chloro-N-methyl-5-methylsulfonylbenzamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)c1cc(S(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C14H13BrClNO3S2/c1-17(7-10-5-9(15)8-21-10)14(18)12-6-11(22(2,19)20)3-4-13(12)16/h3-6,8H,7H2,1-2H3 |
| InChIKey | LKSFIHPYFVUOKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |