C25H26N4O5S — CID 55780841
N,4-dimethyl-N-[4-[4-(3-nitrophenyl)piperazine-1-carbonyl]phenyl]benzenesulfonamide (PubChem CID 55780841) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is N,4-dimethyl-N-[4-[4-(3-nitrophenyl)piperazine-1-carbonyl]phenyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[4-[4-(3-nitrophenyl)piperazine-1-carbonyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55780841 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N,4-dimethyl-N-[4-[4-(3-nitrophenyl)piperazine-1-carbonyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N3CCN(c4cccc([N+](=O)[O-])c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O5S/c1-19-6-12-24(13-7-19)35(33,34)26(2)21-10-8-20(9-11-21)25(30)28-16-14-27(15-17-28)22-4-3-5-23(18-22)29(31)32/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | FCIPVZGALZEJPL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|