C20H21ClN2O5 — CID 55781822
methyl 2-[[2-[4-[3-(3-chlorophenoxy)propanoylamino]phenyl]acetyl]amino]acetate (PubChem CID 55781822) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is methyl 2-[[2-[4-[3-(3-chlorophenoxy)propanoylamino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[3-(3-chlorophenoxy)propanoylamino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 55781822 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl 2-[[2-[4-[3-(3-chlorophenoxy)propanoylamino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)CCOc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-27-20(26)13-22-19(25)11-14-5-7-16(8-6-14)23-18(24)9-10-28-17-4-2-3-15(21)12-17/h2-8,12H,9-11,13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | MRXQKVNZCSZQJK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |