C17H16BrIN2O2 — CID 55782441
3-[(5-bromo-2-iodobenzoyl)amino]-N-ethyl-4-methylbenzamide (PubChem CID 55782441) has the molecular formula C17H16BrIN2O2 and a molecular weight of 487.14 g/mol. Its IUPAC name is 3-[(5-bromo-2-iodobenzoyl)amino]-N-ethyl-4-methylbenzamide.
| Compound Name | 3-[(5-bromo-2-iodobenzoyl)amino]-N-ethyl-4-methylbenzamide |
|---|---|
| PubChem CID | 55782441 |
| Molecular Formula | C17H16BrIN2O2 |
| Molecular Weight | 487.14 g/mol |
| Exact Mass | 485.94 |
| IUPAC Name | 3-[(5-bromo-2-iodobenzoyl)amino]-N-ethyl-4-methylbenzamide |
| SMILES | CCNC(=O)c1ccc(C)c(NC(=O)c2cc(Br)ccc2I)c1 |
| InChI | InChI=1S/C17H16BrIN2O2/c1-3-20-16(22)11-5-4-10(2)15(8-11)21-17(23)13-9-12(18)6-7-14(13)19/h4-9H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | CATCXBJWXBJYRK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|